![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 1- 10 recognition.pdf | 2025-05-10 12:38 | 1.6M | |
| 1 To 8 Recognition N..> | 2025-05-05 10:54 | 1.0M | |
| 8 To 10 Recognition ..> | 2025-05-05 10:54 | 638K | |
| Bharathi School of E..> | 2025-05-05 10:54 | 748K | |
| Bulding Saffty_0001.pdf | 2025-05-05 10:54 | 159K | |
| Drinking Water Lab T..> | 2025-05-05 10:54 | 237K | |
| Drinking Water_0001.pdf | 2025-05-05 10:54 | 147K | |
| FEE structure .pdf | 2025-05-19 15:56 | 362K | |
| FEE structure17.pdf | 2025-05-25 10:41 | 362K | |
| Fees structure.pdf | 2025-05-10 12:42 | 235K | |
| Land Grant Certifica..> | 2025-05-05 10:54 | 229K | |
| NOC.pdf | 2025-05-05 10:54 | 754K | |
| Name Correction.pdf | 2025-05-05 10:54 | 603K | |
| PTA.pdf | 2025-05-19 15:56 | 393K | |
| PTA SHEET.docx | 2025-05-05 10:54 | 13K | |
| PTA SHEET.pdf | 2025-05-10 12:38 | 200K | |
| SMC (1).pdf | 2025-05-19 15:56 | 392K | |
| SMC.pdf | 2025-05-10 12:38 | 350K | |
| SMC17.pdf | 2025-05-25 10:40 | 455K | |
| STS _ Fees Discloser..> | 2025-05-10 12:38 | 235K | |
| TRUST DEED.pdf | 2025-05-05 10:54 | 3.9M | |
| caender of 2024-25 p..> | 2025-05-05 10:54 | 29K | |
| caender of 2024-25 p..> | 2025-05-10 12:38 | 518K | |
| calendar of events ..> | 2025-05-27 10:52 | 381K | |
| calendar of events .pdf | 2025-05-19 15:56 | 381K | |
| recognition merged.pdf | 2025-05-22 16:12 | 3.7M | |
| school mandatory doc..> | 2025-05-05 10:54 | 126K | |